C18H19Cl2N5S — CID 9152021
3-(2,5-dichlorophenyl)-4-[(Z)-(2,5-dimethyl-1-propan-2-ylpyrrol-3-yl)methylideneamino]-1H-1,2,4-triazole-5-thione (PubChem CID 9152021) has the molecular formula C18H19Cl2N5S and a molecular weight of 408.36 g/mol. Its IUPAC name is 3-(2,5-dichlorophenyl)-4-[(Z)-(2,5-dimethyl-1-propan-2-ylpyrrol-3-yl)methylideneamino]-1H-1,2,4-triazole-5-thione.
| Compound Name | 3-(2,5-dichlorophenyl)-4-[(Z)-(2,5-dimethyl-1-propan-2-ylpyrrol-3-yl)methylideneamino]-1H-1,2,4-triazole-5-thione |
|---|---|
| PubChem CID | 9152021 |
| Molecular Formula | C18H19Cl2N5S |
| Molecular Weight | 408.36 g/mol |
| Exact Mass | 407.07 |
| IUPAC Name | 3-(2,5-dichlorophenyl)-4-[(Z)-(2,5-dimethyl-1-propan-2-ylpyrrol-3-yl)methylideneamino]-1H-1,2,4-triazole-5-thione |
| SMILES | Cc1cc(/C=N\n2c(-c3cc(Cl)ccc3Cl)n[nH]c2=S)c(C)n1C(C)C |
| InChI | InChI=1S/C18H19Cl2N5S/c1-10(2)24-11(3)7-13(12(24)4)9-21-25-17(22-23-18(25)26)15-8-14(19)5-6-16(15)20/h5-10H,1-4H3,(H,23,26)/b21-9- |
| InChIKey | OIJHEEGKVYDGLU-NKVSQWTQSA-N |
| XLogP | 5.80 |
| TPSA | 50.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.36 |
| LogP ≤ 5 | 5.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|