C18H13Cl2N5S — CID 135846452
3-(2,5-dichlorophenyl)-4-[(E)-(2-methyl-1H-indol-3-yl)methylideneamino]-1H-1,2,4-triazole-5-thione (PubChem CID 135846452) has the molecular formula C18H13Cl2N5S and a molecular weight of 402.31 g/mol. Its IUPAC name is 3-(2,5-dichlorophenyl)-4-[(E)-(2-methyl-1H-indol-3-yl)methylideneamino]-1H-1,2,4-triazole-5-thione.
| Compound Name | 3-(2,5-dichlorophenyl)-4-[(E)-(2-methyl-1H-indol-3-yl)methylideneamino]-1H-1,2,4-triazole-5-thione |
|---|---|
| PubChem CID | 135846452 |
| Molecular Formula | C18H13Cl2N5S |
| Molecular Weight | 402.31 g/mol |
| Exact Mass | 401.03 |
| IUPAC Name | 3-(2,5-dichlorophenyl)-4-[(E)-(2-methyl-1H-indol-3-yl)methylideneamino]-1H-1,2,4-triazole-5-thione |
| SMILES | Cc1[nH]c2ccccc2c1/C=N/n1c(-c2cc(Cl)ccc2Cl)n[nH]c1=S |
| InChI | InChI=1S/C18H13Cl2N5S/c1-10-14(12-4-2-3-5-16(12)22-10)9-21-25-17(23-24-18(25)26)13-8-11(19)6-7-15(13)20/h2-9,22H,1H3,(H,24,26)/b21-9+ |
| InChIKey | WMHXMVKUUNJBRQ-ZVBGSRNCSA-N |
| XLogP | 5.59 |
| TPSA | 61.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.31 |
| LogP ≤ 5 | 5.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|