C19H17N5S — CID 135620411
4-[(E)-(2-methyl-1H-indol-3-yl)methylideneamino]-3-(2-methylphenyl)-1H-1,2,4-triazole-5-thione (PubChem CID 135620411) has the molecular formula C19H17N5S and a molecular weight of 347.45 g/mol. Its IUPAC name is 4-[(E)-(2-methyl-1H-indol-3-yl)methylideneamino]-3-(2-methylphenyl)-1H-1,2,4-triazole-5-thione.
| Compound Name | 4-[(E)-(2-methyl-1H-indol-3-yl)methylideneamino]-3-(2-methylphenyl)-1H-1,2,4-triazole-5-thione |
|---|---|
| PubChem CID | 135620411 |
| Molecular Formula | C19H17N5S |
| Molecular Weight | 347.45 g/mol |
| Exact Mass | 347.12 |
| IUPAC Name | 4-[(E)-(2-methyl-1H-indol-3-yl)methylideneamino]-3-(2-methylphenyl)-1H-1,2,4-triazole-5-thione |
| SMILES | Cc1ccccc1-c1n[nH]c(=S)n1/N=C/c1c(C)[nH]c2ccccc12 |
| InChI | InChI=1S/C19H17N5S/c1-12-7-3-4-8-14(12)18-22-23-19(25)24(18)20-11-16-13(2)21-17-10-6-5-9-15(16)17/h3-11,21H,1-2H3,(H,23,25)/b20-11+ |
| InChIKey | MDRVKNXPLFUUKC-RGVLZGJSSA-N |
| XLogP | 4.59 |
| TPSA | 61.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.45 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|