C22H22N6S — CID 4856529
4-[(1-benzyl-3,5-dimethylpyrazol-4-yl)methylideneamino]-3-(2-methylphenyl)-1H-1,2,4-triazole-5-thione (PubChem CID 4856529) has the molecular formula C22H22N6S and a molecular weight of 402.53 g/mol. Its IUPAC name is 4-[(1-benzyl-3,5-dimethylpyrazol-4-yl)methylideneamino]-3-(2-methylphenyl)-1H-1,2,4-triazole-5-thione.
| Compound Name | 4-[(1-benzyl-3,5-dimethylpyrazol-4-yl)methylideneamino]-3-(2-methylphenyl)-1H-1,2,4-triazole-5-thione |
|---|---|
| PubChem CID | 4856529 |
| Molecular Formula | C22H22N6S |
| Molecular Weight | 402.53 g/mol |
| Exact Mass | 402.16 |
| IUPAC Name | 4-[(1-benzyl-3,5-dimethylpyrazol-4-yl)methylideneamino]-3-(2-methylphenyl)-1H-1,2,4-triazole-5-thione |
| SMILES | Cc1ccccc1-c1n[nH]c(=S)n1N=Cc1c(C)nn(Cc2ccccc2)c1C |
| InChI | InChI=1S/C22H22N6S/c1-15-9-7-8-12-19(15)21-24-25-22(29)28(21)23-13-20-16(2)26-27(17(20)3)14-18-10-5-4-6-11-18/h4-13H,14H2,1-3H3,(H,25,29) |
| InChIKey | WACNLEOEHSYDDV-UHFFFAOYSA-N |
| XLogP | 4.66 |
| TPSA | 63.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.53 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|