C22H21FN6S — CID 9239784
4-[(Z)-[3,5-dimethyl-1-[(4-methylphenyl)methyl]pyrazol-4-yl]methylideneamino]-3-(3-fluorophenyl)-1H-1,2,4-triazole-5-thione (PubChem CID 9239784) has the molecular formula C22H21FN6S and a molecular weight of 420.52 g/mol. Its IUPAC name is 4-[(Z)-[3,5-dimethyl-1-[(4-methylphenyl)methyl]pyrazol-4-yl]methylideneamino]-3-(3-fluorophenyl)-1H-1,2,4-triazole-5-thione.
| Compound Name | 4-[(Z)-[3,5-dimethyl-1-[(4-methylphenyl)methyl]pyrazol-4-yl]methylideneamino]-3-(3-fluorophenyl)-1H-1,2,4-triazole-5-thione |
|---|---|
| PubChem CID | 9239784 |
| Molecular Formula | C22H21FN6S |
| Molecular Weight | 420.52 g/mol |
| Exact Mass | 420.15 |
| IUPAC Name | 4-[(Z)-[3,5-dimethyl-1-[(4-methylphenyl)methyl]pyrazol-4-yl]methylideneamino]-3-(3-fluorophenyl)-1H-1,2,4-triazole-5-thione |
| SMILES | Cc1ccc(Cn2nc(C)c(/C=N\n3c(-c4cccc(F)c4)n[nH]c3=S)c2C)cc1 |
| InChI | InChI=1S/C22H21FN6S/c1-14-7-9-17(10-8-14)13-28-16(3)20(15(2)27-28)12-24-29-21(25-26-22(29)30)18-5-4-6-19(23)11-18/h4-12H,13H2,1-3H3,(H,26,30)/b24-12- |
| InChIKey | FBDBWKHZUMOJGO-MSXFZWOLSA-N |
| XLogP | 4.80 |
| TPSA | 63.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.52 |
| LogP ≤ 5 | 4.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|