C20H19N5OS — CID 136873977
3-(2-ethoxyphenyl)-4-[(Z)-(2-methyl-1H-indol-3-yl)methylideneamino]-1H-1,2,4-triazole-5-thione (PubChem CID 136873977) has the molecular formula C20H19N5OS and a molecular weight of 377.47 g/mol. Its IUPAC name is 3-(2-ethoxyphenyl)-4-[(Z)-(2-methyl-1H-indol-3-yl)methylideneamino]-1H-1,2,4-triazole-5-thione.
| Compound Name | 3-(2-ethoxyphenyl)-4-[(Z)-(2-methyl-1H-indol-3-yl)methylideneamino]-1H-1,2,4-triazole-5-thione |
|---|---|
| PubChem CID | 136873977 |
| Molecular Formula | C20H19N5OS |
| Molecular Weight | 377.47 g/mol |
| Exact Mass | 377.13 |
| IUPAC Name | 3-(2-ethoxyphenyl)-4-[(Z)-(2-methyl-1H-indol-3-yl)methylideneamino]-1H-1,2,4-triazole-5-thione |
| SMILES | CCOc1ccccc1-c1n[nH]c(=S)n1/N=C\c1c(C)[nH]c2ccccc12 |
| InChI | InChI=1S/C20H19N5OS/c1-3-26-18-11-7-5-9-15(18)19-23-24-20(27)25(19)21-12-16-13(2)22-17-10-6-4-8-14(16)17/h4-12,22H,3H2,1-2H3,(H,24,27)/b21-12- |
| InChIKey | UJWGMICORKRPIU-MTJSOVHGSA-N |
| XLogP | 4.68 |
| TPSA | 70.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.47 |
| LogP ≤ 5 | 4.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|