C17H12ClN5S — CID 135684599
3-(4-chlorophenyl)-4-[(E)-1H-indol-3-ylmethylideneamino]-1H-1,2,4-triazole-5-thione (PubChem CID 135684599) has the molecular formula C17H12ClN5S and a molecular weight of 353.84 g/mol. Its IUPAC name is 3-(4-chlorophenyl)-4-[(E)-1H-indol-3-ylmethylideneamino]-1H-1,2,4-triazole-5-thione.
| Compound Name | 3-(4-chlorophenyl)-4-[(E)-1H-indol-3-ylmethylideneamino]-1H-1,2,4-triazole-5-thione |
|---|---|
| PubChem CID | 135684599 |
| Molecular Formula | C17H12ClN5S |
| Molecular Weight | 353.84 g/mol |
| Exact Mass | 353.05 |
| IUPAC Name | 3-(4-chlorophenyl)-4-[(E)-1H-indol-3-ylmethylideneamino]-1H-1,2,4-triazole-5-thione |
| SMILES | S=c1[nH]nc(-c2ccc(Cl)cc2)n1/N=C/c1c[nH]c2ccccc12 |
| InChI | InChI=1S/C17H12ClN5S/c18-13-7-5-11(6-8-13)16-21-22-17(24)23(16)20-10-12-9-19-15-4-2-1-3-14(12)15/h1-10,19H,(H,22,24)/b20-10+ |
| InChIKey | SSIDVJHCUGWXRD-KEBDBYFISA-N |
| XLogP | 4.62 |
| TPSA | 61.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.84 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|