C20H17ClN6S — CID 6861210
3-(4-chlorophenyl)-4-[(E)-(3,5-dimethyl-1-phenylpyrazol-4-yl)methylideneamino]-1H-1,2,4-triazole-5-thione (PubChem CID 6861210) has the molecular formula C20H17ClN6S and a molecular weight of 408.92 g/mol. Its IUPAC name is 3-(4-chlorophenyl)-4-[(E)-(3,5-dimethyl-1-phenylpyrazol-4-yl)methylideneamino]-1H-1,2,4-triazole-5-thione.
| Compound Name | 3-(4-chlorophenyl)-4-[(E)-(3,5-dimethyl-1-phenylpyrazol-4-yl)methylideneamino]-1H-1,2,4-triazole-5-thione |
|---|---|
| PubChem CID | 6861210 |
| Molecular Formula | C20H17ClN6S |
| Molecular Weight | 408.92 g/mol |
| Exact Mass | 408.09 |
| IUPAC Name | 3-(4-chlorophenyl)-4-[(E)-(3,5-dimethyl-1-phenylpyrazol-4-yl)methylideneamino]-1H-1,2,4-triazole-5-thione |
| SMILES | Cc1nn(-c2ccccc2)c(C)c1/C=N/n1c(-c2ccc(Cl)cc2)n[nH]c1=S |
| InChI | InChI=1S/C20H17ClN6S/c1-13-18(14(2)26(25-13)17-6-4-3-5-7-17)12-22-27-19(23-24-20(27)28)15-8-10-16(21)11-9-15/h3-12H,1-2H3,(H,24,28)/b22-12+ |
| InChIKey | LWSYTJWXSMGIKM-WSDLNYQXSA-N |
| XLogP | 4.95 |
| TPSA | 63.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.92 |
| LogP ≤ 5 | 4.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|