C17H13ClN4S — CID 3771771
3-(4-chlorophenyl)-4-(cinnamylideneamino)-1H-1,2,4-triazole-5-thione (PubChem CID 3771771) has the molecular formula C17H13ClN4S and a molecular weight of 340.84 g/mol. Its IUPAC name is 3-(4-chlorophenyl)-4-(cinnamylideneamino)-1H-1,2,4-triazole-5-thione.
| Compound Name | 3-(4-chlorophenyl)-4-(cinnamylideneamino)-1H-1,2,4-triazole-5-thione |
|---|---|
| PubChem CID | 3771771 |
| Molecular Formula | C17H13ClN4S |
| Molecular Weight | 340.84 g/mol |
| Exact Mass | 340.05 |
| IUPAC Name | 3-(4-chlorophenyl)-4-(cinnamylideneamino)-1H-1,2,4-triazole-5-thione |
| SMILES | S=c1[nH]nc(-c2ccc(Cl)cc2)n1N=CC=Cc1ccccc1 |
| InChI | InChI=1S/C17H13ClN4S/c18-15-10-8-14(9-11-15)16-20-21-17(23)22(16)19-12-4-7-13-5-2-1-3-6-13/h1-12H,(H,21,23) |
| InChIKey | SNYLSSXZGDASSB-UHFFFAOYSA-N |
| XLogP | 4.81 |
| TPSA | 45.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.84 |
| LogP ≤ 5 | 4.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|