C15H12Cl2N6S — CID 6860662
4-[(E)-(2,4-dichlorophenyl)methylideneamino]-3-(1,4,5,6-tetrahydrocyclopenta[d]pyrazol-3-yl)-1H-1,2,4-triazole-5-thione (PubChem CID 6860662) has the molecular formula C15H12Cl2N6S and a molecular weight of 379.28 g/mol. Its IUPAC name is 4-[(E)-(2,4-dichlorophenyl)methylideneamino]-3-(1,4,5,6-tetrahydrocyclopenta[d]pyrazol-3-yl)-1H-1,2,4-triazole-5-thione.
| Compound Name | 4-[(E)-(2,4-dichlorophenyl)methylideneamino]-3-(1,4,5,6-tetrahydrocyclopenta[d]pyrazol-3-yl)-1H-1,2,4-triazole-5-thione |
|---|---|
| PubChem CID | 6860662 |
| Molecular Formula | C15H12Cl2N6S |
| Molecular Weight | 379.28 g/mol |
| Exact Mass | 378.02 |
| IUPAC Name | 4-[(E)-(2,4-dichlorophenyl)methylideneamino]-3-(1,4,5,6-tetrahydrocyclopenta[d]pyrazol-3-yl)-1H-1,2,4-triazole-5-thione |
| SMILES | S=c1[nH]nc(-c2n[nH]c3c2CCC3)n1/N=C/c1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C15H12Cl2N6S/c16-9-5-4-8(11(17)6-9)7-18-23-14(21-22-15(23)24)13-10-2-1-3-12(10)19-20-13/h4-7H,1-3H2,(H,19,20)(H,22,24)/b18-7+ |
| InChIKey | FVNBBCZSWFKSGW-CNHKJKLMSA-N |
| XLogP | 4.01 |
| TPSA | 74.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.28 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|