C22H20N6OS — CID 1400914
4-[(4-phenylmethoxyphenyl)methylideneamino]-3-(1,4,5,6-tetrahydrocyclopenta[d]pyrazol-3-yl)-1H-1,2,4-triazole-5-thione (PubChem CID 1400914) has the molecular formula C22H20N6OS and a molecular weight of 416.51 g/mol. Its IUPAC name is 4-[(4-phenylmethoxyphenyl)methylideneamino]-3-(1,4,5,6-tetrahydrocyclopenta[d]pyrazol-3-yl)-1H-1,2,4-triazole-5-thione.
| Compound Name | 4-[(4-phenylmethoxyphenyl)methylideneamino]-3-(1,4,5,6-tetrahydrocyclopenta[d]pyrazol-3-yl)-1H-1,2,4-triazole-5-thione |
|---|---|
| PubChem CID | 1400914 |
| Molecular Formula | C22H20N6OS |
| Molecular Weight | 416.51 g/mol |
| Exact Mass | 416.14 |
| IUPAC Name | 4-[(4-phenylmethoxyphenyl)methylideneamino]-3-(1,4,5,6-tetrahydrocyclopenta[d]pyrazol-3-yl)-1H-1,2,4-triazole-5-thione |
| SMILES | S=c1[nH]nc(-c2n[nH]c3c2CCC3)n1N=Cc1ccc(OCc2ccccc2)cc1 |
| InChI | InChI=1S/C22H20N6OS/c30-22-27-26-21(20-18-7-4-8-19(18)24-25-20)28(22)23-13-15-9-11-17(12-10-15)29-14-16-5-2-1-3-6-16/h1-3,5-6,9-13H,4,7-8,14H2,(H,24,25)(H,27,30) |
| InChIKey | IFJBDJDTCSUQGT-UHFFFAOYSA-N |
| XLogP | 4.28 |
| TPSA | 83.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.51 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|