C13H12N6OS — CID 1397011
4-(furan-2-ylmethylideneamino)-3-(1,4,5,6-tetrahydrocyclopenta[d]pyrazol-3-yl)-1H-1,2,4-triazole-5-thione (PubChem CID 1397011) has the molecular formula C13H12N6OS and a molecular weight of 300.35 g/mol. Its IUPAC name is 4-(furan-2-ylmethylideneamino)-3-(1,4,5,6-tetrahydrocyclopenta[d]pyrazol-3-yl)-1H-1,2,4-triazole-5-thione.
| Compound Name | 4-(furan-2-ylmethylideneamino)-3-(1,4,5,6-tetrahydrocyclopenta[d]pyrazol-3-yl)-1H-1,2,4-triazole-5-thione |
|---|---|
| PubChem CID | 1397011 |
| Molecular Formula | C13H12N6OS |
| Molecular Weight | 300.35 g/mol |
| Exact Mass | 300.08 |
| IUPAC Name | 4-(furan-2-ylmethylideneamino)-3-(1,4,5,6-tetrahydrocyclopenta[d]pyrazol-3-yl)-1H-1,2,4-triazole-5-thione |
| SMILES | S=c1[nH]nc(-c2n[nH]c3c2CCC3)n1N=Cc1ccco1 |
| InChI | InChI=1S/C13H12N6OS/c21-13-18-17-12(11-9-4-1-5-10(9)15-16-11)19(13)14-7-8-3-2-6-20-8/h2-3,6-7H,1,4-5H2,(H,15,16)(H,18,21) |
| InChIKey | RLTJCCYDTBGOQU-UHFFFAOYSA-N |
| XLogP | 2.29 |
| TPSA | 87.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.35 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|