C8H8N4OS — CID 2728541
4-(furan-2-ylmethylideneamino)-3-methyl-1H-1,2,4-triazole-5-thione (PubChem CID 2728541) has the molecular formula C8H8N4OS and a molecular weight of 208.25 g/mol. Its IUPAC name is 4-(furan-2-ylmethylideneamino)-3-methyl-1H-1,2,4-triazole-5-thione.
| Compound Name | 4-(furan-2-ylmethylideneamino)-3-methyl-1H-1,2,4-triazole-5-thione |
|---|---|
| PubChem CID | 2728541 |
| Molecular Formula | C8H8N4OS |
| Molecular Weight | 208.25 g/mol |
| Exact Mass | 208.04 |
| IUPAC Name | 4-(furan-2-ylmethylideneamino)-3-methyl-1H-1,2,4-triazole-5-thione |
| SMILES | Cc1n[nH]c(=S)n1N=Cc1ccco1 |
| InChI | InChI=1S/C8H8N4OS/c1-6-10-11-8(14)12(6)9-5-7-3-2-4-13-7/h2-5H,1H3,(H,11,14) |
| InChIKey | KOCYVBYFAVOGAN-UHFFFAOYSA-N |
| XLogP | 1.72 |
| TPSA | 59.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 208.25 |
| LogP ≤ 5 | 1.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|