About N-(3,5-dimethyl-1,2,4-triazol-4-yl)-1-(furan-2-yl)methanimine
N-(3,5-dimethyl-1,2,4-triazol-4-yl)-1-(furan-2-yl)methanimine (PubChem CID 726902) has the molecular formula C9H10N4O
and a molecular weight of 190.21 g/mol. Its IUPAC name is N-(3,5-dimethyl-1,2,4-triazol-4-yl)-1-(furan-2-yl)methanimine.
Molecular Properties
| Compound Name | N-(3,5-dimethyl-1,2,4-triazol-4-yl)-1-(furan-2-yl)methanimine |
| PubChem CID | 726902 |
| Molecular Formula | C9H10N4O |
| Molecular Weight | 190.21 g/mol |
| Exact Mass | 190.09 |
| IUPAC Name | N-(3,5-dimethyl-1,2,4-triazol-4-yl)-1-(furan-2-yl)methanimine |
| SMILES | Cc1nnc(C)n1N=Cc1ccco1 |
| InChI | InChI=1S/C9H10N4O/c1-7-11-12-8(2)13(7)10-6-9-4-3-5-14-9/h3-6H,1-2H3 |
| InChIKey | COBJDQRPMFZRMM-UHFFFAOYSA-N |
| XLogP | 1.37 |
| TPSA | 56.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 190.21 |
| LogP ≤ 5 | 1.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze N-(3,5-dimethyl-1,2,4-triazol-4-yl)-1-(furan-2-yl)methanimine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(3,5-dimethyl-1,2,4-triazol-4-yl)-1-(furan-2-yl)methanimine?
The IUPAC name of N-(3,5-dimethyl-1,2,4-triazol-4-yl)-1-(furan-2-yl)methanimine (CID 726902) is N-(3,5-dimethyl-1,2,4-triazol-4-yl)-1-(furan-2-yl)methanimine.
What is the SMILES notation for N-(3,5-dimethyl-1,2,4-triazol-4-yl)-1-(furan-2-yl)methanimine?
The canonical SMILES for N-(3,5-dimethyl-1,2,4-triazol-4-yl)-1-(furan-2-yl)methanimine is Cc1nnc(C)n1N=Cc1ccco1.
What is the InChIKey of N-(3,5-dimethyl-1,2,4-triazol-4-yl)-1-(furan-2-yl)methanimine?
The InChIKey is COBJDQRPMFZRMM-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H10N4O/c1-7-11-12-8(2)13(7)10-6-9-4-3-5-14-9/h3-6H,1-2H3.
What are the key properties of N-(3,5-dimethyl-1,2,4-triazol-4-yl)-1-(furan-2-yl)methanimine?
N-(3,5-dimethyl-1,2,4-triazol-4-yl)-1-(furan-2-yl)methanimine has a molecular weight of 190.21 g/mol, XLogP of 1.37, 2 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for N-(3,5-dimethyl-1,2,4-triazol-4-yl)-1-(furan-2-yl)methanimine is sourced from PubChem (CID 726902), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).