C10H13ClN4OSSn — CID 25146452
chloro(dimethyl)stannanylium;4-[(E)-furan-2-ylmethylideneamino]-5-methyl-1,2,4-triazole-3-thiolate (PubChem CID 25146452) has the molecular formula C10H13ClN4OSSn and a molecular weight of 391.47 g/mol. Its IUPAC name is chloro(dimethyl)stannanylium;4-[(E)-furan-2-ylmethylideneamino]-5-methyl-1,2,4-triazole-3-thiolate.
| Compound Name | chloro(dimethyl)stannanylium;4-[(E)-furan-2-ylmethylideneamino]-5-methyl-1,2,4-triazole-3-thiolate |
|---|---|
| PubChem CID | 25146452 |
| Molecular Formula | C10H13ClN4OSSn |
| Molecular Weight | 391.47 g/mol |
| Exact Mass | 391.95 |
| IUPAC Name | chloro(dimethyl)stannanylium;4-[(E)-furan-2-ylmethylideneamino]-5-methyl-1,2,4-triazole-3-thiolate |
| SMILES | C[Sn+](C)Cl.Cc1nnc([S-])n1/N=C/c1ccco1 |
| InChI | InChI=1S/C8H8N4OS.2CH3.ClH.Sn/c1-6-10-11-8(14)12(6)9-5-7-3-2-4-13-7;;;;/h2-5H,1H3,(H,11,14);2*1H3;1H;/q;;;;+2/p-2/b9-5+;;;; |
| InChIKey | RSECXEFJSGCYSY-VMFMELAVSA-L |
| XLogP | 2.44 |
| TPSA | 56.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.47 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'thiol_1', 'substructure': 'N/A'} |
|---|