C13H15N3OS — CID 6904728
(E)-3-[(E)-furan-2-ylmethylideneamino]-4-methyl-N-(2-methylprop-2-enyl)-1,3-thiazol-2-imine (PubChem CID 6904728) has the molecular formula C13H15N3OS and a molecular weight of 261.35 g/mol. Its IUPAC name is (E)-3-[(E)-furan-2-ylmethylideneamino]-4-methyl-N-(2-methylprop-2-enyl)-1,3-thiazol-2-imine.
| Compound Name | (E)-3-[(E)-furan-2-ylmethylideneamino]-4-methyl-N-(2-methylprop-2-enyl)-1,3-thiazol-2-imine |
|---|---|
| PubChem CID | 6904728 |
| Molecular Formula | C13H15N3OS |
| Molecular Weight | 261.35 g/mol |
| Exact Mass | 261.09 |
| IUPAC Name | (E)-3-[(E)-furan-2-ylmethylideneamino]-4-methyl-N-(2-methylprop-2-enyl)-1,3-thiazol-2-imine |
| SMILES | C=C(C)C/N=c1\scc(C)n1/N=C/c1ccco1 |
| InChI | InChI=1S/C13H15N3OS/c1-10(2)7-14-13-16(11(3)9-18-13)15-8-12-5-4-6-17-12/h4-6,8-9H,1,7H2,2-3H3/b14-13-,15-8+ |
| InChIKey | MBXPWGZGCVBITK-PYJOTRNSSA-N |
| XLogP | 2.81 |
| TPSA | 42.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.35 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|