C20H17Cl2N3OS — CID 135709953
4-[[4-(2,4-dichlorophenyl)-2-(2-methylprop-2-enylimino)-1,3-thiazol-3-yl]iminomethyl]phenol (PubChem CID 135709953) has the molecular formula C20H17Cl2N3OS and a molecular weight of 418.35 g/mol. Its IUPAC name is 4-[[4-(2,4-dichlorophenyl)-2-(2-methylprop-2-enylimino)-1,3-thiazol-3-yl]iminomethyl]phenol.
| Compound Name | 4-[[4-(2,4-dichlorophenyl)-2-(2-methylprop-2-enylimino)-1,3-thiazol-3-yl]iminomethyl]phenol |
|---|---|
| PubChem CID | 135709953 |
| Molecular Formula | C20H17Cl2N3OS |
| Molecular Weight | 418.35 g/mol |
| Exact Mass | 417.05 |
| IUPAC Name | 4-[[4-(2,4-dichlorophenyl)-2-(2-methylprop-2-enylimino)-1,3-thiazol-3-yl]iminomethyl]phenol |
| SMILES | C=C(C)C/N=c1\scc(-c2ccc(Cl)cc2Cl)n1N=Cc1ccc(O)cc1 |
| InChI | InChI=1S/C20H17Cl2N3OS/c1-13(2)10-23-20-25(24-11-14-3-6-16(26)7-4-14)19(12-27-20)17-8-5-15(21)9-18(17)22/h3-9,11-12,26H,1,10H2,2H3/b23-20-,24-11? |
| InChIKey | LNLOWXQUFHGUBK-IAMPVFOGSA-N |
| XLogP | 5.59 |
| TPSA | 49.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.35 |
| LogP ≤ 5 | 5.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hzone_phenol_B(215)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|