C19H17Cl2N3O2S — CID 135693029
4-[[4-(2,4-dichlorophenyl)-2-propan-2-ylimino-1,3-thiazol-3-yl]iminomethyl]benzene-1,3-diol (PubChem CID 135693029) has the molecular formula C19H17Cl2N3O2S and a molecular weight of 422.34 g/mol. Its IUPAC name is 4-[[4-(2,4-dichlorophenyl)-2-propan-2-ylimino-1,3-thiazol-3-yl]iminomethyl]benzene-1,3-diol.
| Compound Name | 4-[[4-(2,4-dichlorophenyl)-2-propan-2-ylimino-1,3-thiazol-3-yl]iminomethyl]benzene-1,3-diol |
|---|---|
| PubChem CID | 135693029 |
| Molecular Formula | C19H17Cl2N3O2S |
| Molecular Weight | 422.34 g/mol |
| Exact Mass | 421.04 |
| IUPAC Name | 4-[[4-(2,4-dichlorophenyl)-2-propan-2-ylimino-1,3-thiazol-3-yl]iminomethyl]benzene-1,3-diol |
| SMILES | CC(C)/N=c1\scc(-c2ccc(Cl)cc2Cl)n1N=Cc1ccc(O)cc1O |
| InChI | InChI=1S/C19H17Cl2N3O2S/c1-11(2)23-19-24(22-9-12-3-5-14(25)8-18(12)26)17(10-27-19)15-6-4-13(20)7-16(15)21/h3-11,25-26H,1-2H3/b22-9?,23-19- |
| InChIKey | ROAUETYWGJLKRB-IQIPOLMASA-N |
| XLogP | 5.13 |
| TPSA | 70.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.34 |
| LogP ≤ 5 | 5.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hzone_phenol_A(479)', 'substructure': 'N/A'}, {'alert_name': 'hzone_phenol_B(215)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|