C23H18FN3O2S — CID 135823393
4-[[2-benzylimino-4-(2-fluorophenyl)-1,3-thiazol-3-yl]iminomethyl]benzene-1,3-diol (PubChem CID 135823393) has the molecular formula C23H18FN3O2S and a molecular weight of 419.48 g/mol. Its IUPAC name is 4-[[2-benzylimino-4-(2-fluorophenyl)-1,3-thiazol-3-yl]iminomethyl]benzene-1,3-diol.
| Compound Name | 4-[[2-benzylimino-4-(2-fluorophenyl)-1,3-thiazol-3-yl]iminomethyl]benzene-1,3-diol |
|---|---|
| PubChem CID | 135823393 |
| Molecular Formula | C23H18FN3O2S |
| Molecular Weight | 419.48 g/mol |
| Exact Mass | 419.11 |
| IUPAC Name | 4-[[2-benzylimino-4-(2-fluorophenyl)-1,3-thiazol-3-yl]iminomethyl]benzene-1,3-diol |
| SMILES | Oc1ccc(C=Nn2c(-c3ccccc3F)cs/c2=N\Cc2ccccc2)c(O)c1 |
| InChI | InChI=1S/C23H18FN3O2S/c24-20-9-5-4-8-19(20)21-15-30-23(25-13-16-6-2-1-3-7-16)27(21)26-14-17-10-11-18(28)12-22(17)29/h1-12,14-15,28-29H,13H2/b25-23-,26-14? |
| InChIKey | OKFRMFQUSRHHMI-REWQIIKUSA-N |
| XLogP | 4.75 |
| TPSA | 70.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.48 |
| LogP ≤ 5 | 4.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hzone_phenol_A(479)', 'substructure': 'N/A'}, {'alert_name': 'hzone_phenol_B(215)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|