C17H15N3O2S2 — CID 135721962
4-[(2-prop-2-enylimino-4-thiophen-2-yl-1,3-thiazol-3-yl)iminomethyl]benzene-1,3-diol (PubChem CID 135721962) has the molecular formula C17H15N3O2S2 and a molecular weight of 357.46 g/mol. Its IUPAC name is 4-[(2-prop-2-enylimino-4-thiophen-2-yl-1,3-thiazol-3-yl)iminomethyl]benzene-1,3-diol.
| Compound Name | 4-[(2-prop-2-enylimino-4-thiophen-2-yl-1,3-thiazol-3-yl)iminomethyl]benzene-1,3-diol |
|---|---|
| PubChem CID | 135721962 |
| Molecular Formula | C17H15N3O2S2 |
| Molecular Weight | 357.46 g/mol |
| Exact Mass | 357.06 |
| IUPAC Name | 4-[(2-prop-2-enylimino-4-thiophen-2-yl-1,3-thiazol-3-yl)iminomethyl]benzene-1,3-diol |
| SMILES | C=CC/N=c1\scc(-c2cccs2)n1N=Cc1ccc(O)cc1O |
| InChI | InChI=1S/C17H15N3O2S2/c1-2-7-18-17-20(14(11-24-17)16-4-3-8-23-16)19-10-12-5-6-13(21)9-15(12)22/h2-6,8-11,21-22H,1,7H2/b18-17-,19-10? |
| InChIKey | XDXFYYNAJBOWOE-OBPOFPIRSA-N |
| XLogP | 3.66 |
| TPSA | 70.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.46 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hzone_phenol_A(479)', 'substructure': 'N/A'}, {'alert_name': 'hzone_phenol_B(215)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|