C15H19N3S2 — CID 23910433
3-(3-methylbutylideneamino)-N-prop-2-enyl-4-thiophen-2-yl-1,3-thiazol-2-imine (PubChem CID 23910433) has the molecular formula C15H19N3S2 and a molecular weight of 305.47 g/mol. Its IUPAC name is 3-(3-methylbutylideneamino)-N-prop-2-enyl-4-thiophen-2-yl-1,3-thiazol-2-imine.
| Compound Name | 3-(3-methylbutylideneamino)-N-prop-2-enyl-4-thiophen-2-yl-1,3-thiazol-2-imine |
|---|---|
| PubChem CID | 23910433 |
| Molecular Formula | C15H19N3S2 |
| Molecular Weight | 305.47 g/mol |
| Exact Mass | 305.10 |
| IUPAC Name | 3-(3-methylbutylideneamino)-N-prop-2-enyl-4-thiophen-2-yl-1,3-thiazol-2-imine |
| SMILES | C=CC/N=c1\scc(-c2cccs2)n1N=CCC(C)C |
| InChI | InChI=1S/C15H19N3S2/c1-4-8-16-15-18(17-9-7-12(2)3)13(11-20-15)14-6-5-10-19-14/h4-6,9-12H,1,7-8H2,2-3H3/b16-15-,17-9? |
| InChIKey | MXTUMTMOUXLBEC-JWTJGMJASA-N |
| XLogP | 4.24 |
| TPSA | 29.65 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.47 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|