C18H14BrF2N3OS2 — CID 2494492
4-(5-bromothiophen-2-yl)-3-[[2-(difluoromethoxy)phenyl]methylideneamino]-N-prop-2-enyl-1,3-thiazol-2-imine (PubChem CID 2494492) has the molecular formula C18H14BrF2N3OS2 and a molecular weight of 470.36 g/mol. Its IUPAC name is 4-(5-bromothiophen-2-yl)-3-[[2-(difluoromethoxy)phenyl]methylideneamino]-N-prop-2-enyl-1,3-thiazol-2-imine.
| Compound Name | 4-(5-bromothiophen-2-yl)-3-[[2-(difluoromethoxy)phenyl]methylideneamino]-N-prop-2-enyl-1,3-thiazol-2-imine |
|---|---|
| PubChem CID | 2494492 |
| Molecular Formula | C18H14BrF2N3OS2 |
| Molecular Weight | 470.36 g/mol |
| Exact Mass | 468.97 |
| IUPAC Name | 4-(5-bromothiophen-2-yl)-3-[[2-(difluoromethoxy)phenyl]methylideneamino]-N-prop-2-enyl-1,3-thiazol-2-imine |
| SMILES | C=CC/N=c1\scc(-c2ccc(Br)s2)n1N=Cc1ccccc1OC(F)F |
| InChI | InChI=1S/C18H14BrF2N3OS2/c1-2-9-22-18-24(13(11-26-18)15-7-8-16(19)27-15)23-10-12-5-3-4-6-14(12)25-17(20)21/h2-8,10-11,17H,1,9H2/b22-18-,23-10? |
| InChIKey | FXQHYZVBBMEPHK-PUGABYLLSA-N |
| XLogP | 5.61 |
| TPSA | 38.88 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.36 |
| LogP ≤ 5 | 5.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|