C23H23F2N3O4S — CID 2436403
4-[4-(difluoromethoxy)phenyl]-N-prop-2-enyl-3-[(2,4,5-trimethoxyphenyl)methylideneamino]-1,3-thiazol-2-imine (PubChem CID 2436403) has the molecular formula C23H23F2N3O4S and a molecular weight of 475.52 g/mol. Its IUPAC name is 4-[4-(difluoromethoxy)phenyl]-N-prop-2-enyl-3-[(2,4,5-trimethoxyphenyl)methylideneamino]-1,3-thiazol-2-imine.
| Compound Name | 4-[4-(difluoromethoxy)phenyl]-N-prop-2-enyl-3-[(2,4,5-trimethoxyphenyl)methylideneamino]-1,3-thiazol-2-imine |
|---|---|
| PubChem CID | 2436403 |
| Molecular Formula | C23H23F2N3O4S |
| Molecular Weight | 475.52 g/mol |
| Exact Mass | 475.14 |
| IUPAC Name | 4-[4-(difluoromethoxy)phenyl]-N-prop-2-enyl-3-[(2,4,5-trimethoxyphenyl)methylideneamino]-1,3-thiazol-2-imine |
| SMILES | C=CC/N=c1\scc(-c2ccc(OC(F)F)cc2)n1N=Cc1cc(OC)c(OC)cc1OC |
| InChI | InChI=1S/C23H23F2N3O4S/c1-5-10-26-23-28(18(14-33-23)15-6-8-17(9-7-15)32-22(24)25)27-13-16-11-20(30-3)21(31-4)12-19(16)29-2/h5-9,11-14,22H,1,10H2,2-4H3/b26-23-,27-13? |
| InChIKey | MCJDFSQTXSJACP-DLXOOOHSSA-N |
| XLogP | 4.81 |
| TPSA | 66.57 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.52 |
| LogP ≤ 5 | 4.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|