C22H21F2N3O3S — CID 135614073
4-[(E)-[4-[4-(difluoromethoxy)phenyl]-2-prop-2-enylimino-1,3-thiazol-3-yl]iminomethyl]-2-ethoxyphenol (PubChem CID 135614073) has the molecular formula C22H21F2N3O3S and a molecular weight of 445.49 g/mol. Its IUPAC name is 4-[(E)-[4-[4-(difluoromethoxy)phenyl]-2-prop-2-enylimino-1,3-thiazol-3-yl]iminomethyl]-2-ethoxyphenol.
| Compound Name | 4-[(E)-[4-[4-(difluoromethoxy)phenyl]-2-prop-2-enylimino-1,3-thiazol-3-yl]iminomethyl]-2-ethoxyphenol |
|---|---|
| PubChem CID | 135614073 |
| Molecular Formula | C22H21F2N3O3S |
| Molecular Weight | 445.49 g/mol |
| Exact Mass | 445.13 |
| IUPAC Name | 4-[(E)-[4-[4-(difluoromethoxy)phenyl]-2-prop-2-enylimino-1,3-thiazol-3-yl]iminomethyl]-2-ethoxyphenol |
| SMILES | C=CC/N=c1\scc(-c2ccc(OC(F)F)cc2)n1/N=C/c1ccc(O)c(OCC)c1 |
| InChI | InChI=1S/C22H21F2N3O3S/c1-3-11-25-22-27(26-13-15-5-10-19(28)20(12-15)29-4-2)18(14-31-22)16-6-8-17(9-7-16)30-21(23)24/h3,5-10,12-14,21,28H,1,4,11H2,2H3/b25-22-,26-13+ |
| InChIKey | NNFLJVBGXFBYFI-YJSNIEKLSA-N |
| XLogP | 4.89 |
| TPSA | 68.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.49 |
| LogP ≤ 5 | 4.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hzone_phenol_B(215)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|