C20H16F2N4OS — CID 6906107
4-[(E)-[4-[4-(difluoromethoxy)phenyl]-2-ethylimino-1,3-thiazol-3-yl]iminomethyl]benzonitrile (PubChem CID 6906107) has the molecular formula C20H16F2N4OS and a molecular weight of 398.44 g/mol. Its IUPAC name is 4-[(E)-[4-[4-(difluoromethoxy)phenyl]-2-ethylimino-1,3-thiazol-3-yl]iminomethyl]benzonitrile.
| Compound Name | 4-[(E)-[4-[4-(difluoromethoxy)phenyl]-2-ethylimino-1,3-thiazol-3-yl]iminomethyl]benzonitrile |
|---|---|
| PubChem CID | 6906107 |
| Molecular Formula | C20H16F2N4OS |
| Molecular Weight | 398.44 g/mol |
| Exact Mass | 398.10 |
| IUPAC Name | 4-[(E)-[4-[4-(difluoromethoxy)phenyl]-2-ethylimino-1,3-thiazol-3-yl]iminomethyl]benzonitrile |
| SMILES | CC/N=c1\scc(-c2ccc(OC(F)F)cc2)n1/N=C/c1ccc(C#N)cc1 |
| InChI | InChI=1S/C20H16F2N4OS/c1-2-24-20-26(25-12-15-5-3-14(11-23)4-6-15)18(13-28-20)16-7-9-17(10-8-16)27-19(21)22/h3-10,12-13,19H,2H2,1H3/b24-20-,25-12+ |
| InChIKey | NIPRKVRLIJIGLP-DKECESECSA-N |
| XLogP | 4.49 |
| TPSA | 62.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.44 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|