C19H15F4N3OS — CID 2451474
4-[4-(difluoromethoxy)phenyl]-3-[(2,6-difluorophenyl)methylideneamino]-N-ethyl-1,3-thiazol-2-imine (PubChem CID 2451474) has the molecular formula C19H15F4N3OS and a molecular weight of 409.41 g/mol. Its IUPAC name is 4-[4-(difluoromethoxy)phenyl]-3-[(2,6-difluorophenyl)methylideneamino]-N-ethyl-1,3-thiazol-2-imine.
| Compound Name | 4-[4-(difluoromethoxy)phenyl]-3-[(2,6-difluorophenyl)methylideneamino]-N-ethyl-1,3-thiazol-2-imine |
|---|---|
| PubChem CID | 2451474 |
| Molecular Formula | C19H15F4N3OS |
| Molecular Weight | 409.41 g/mol |
| Exact Mass | 409.09 |
| IUPAC Name | 4-[4-(difluoromethoxy)phenyl]-3-[(2,6-difluorophenyl)methylideneamino]-N-ethyl-1,3-thiazol-2-imine |
| SMILES | CC/N=c1\scc(-c2ccc(OC(F)F)cc2)n1N=Cc1c(F)cccc1F |
| InChI | InChI=1S/C19H15F4N3OS/c1-2-24-19-26(25-10-14-15(20)4-3-5-16(14)21)17(11-28-19)12-6-8-13(9-7-12)27-18(22)23/h3-11,18H,2H2,1H3/b24-19-,25-10? |
| InChIKey | DUWUQLLYGZYEFY-MMSBHWBCSA-N |
| XLogP | 4.90 |
| TPSA | 38.88 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.41 |
| LogP ≤ 5 | 4.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|