C22H23F2N3O4S — CID 2365286
4-[4-(difluoromethoxy)phenyl]-N-ethyl-3-[(3,4,5-trimethoxyphenyl)methylideneamino]-1,3-thiazol-2-imine (PubChem CID 2365286) has the molecular formula C22H23F2N3O4S and a molecular weight of 463.51 g/mol. Its IUPAC name is 4-[4-(difluoromethoxy)phenyl]-N-ethyl-3-[(3,4,5-trimethoxyphenyl)methylideneamino]-1,3-thiazol-2-imine.
| Compound Name | 4-[4-(difluoromethoxy)phenyl]-N-ethyl-3-[(3,4,5-trimethoxyphenyl)methylideneamino]-1,3-thiazol-2-imine |
|---|---|
| PubChem CID | 2365286 |
| Molecular Formula | C22H23F2N3O4S |
| Molecular Weight | 463.51 g/mol |
| Exact Mass | 463.14 |
| IUPAC Name | 4-[4-(difluoromethoxy)phenyl]-N-ethyl-3-[(3,4,5-trimethoxyphenyl)methylideneamino]-1,3-thiazol-2-imine |
| SMILES | CC/N=c1\scc(-c2ccc(OC(F)F)cc2)n1N=Cc1cc(OC)c(OC)c(OC)c1 |
| InChI | InChI=1S/C22H23F2N3O4S/c1-5-25-22-27(17(13-32-22)15-6-8-16(9-7-15)31-21(23)24)26-12-14-10-18(28-2)20(30-4)19(11-14)29-3/h6-13,21H,5H2,1-4H3/b25-22-,26-12? |
| InChIKey | ACVPHQSTNRWBBX-WUIFGJMWSA-N |
| XLogP | 4.65 |
| TPSA | 66.57 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.51 |
| LogP ≤ 5 | 4.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|