C21H22FN3O3S — CID 7974902
(Z)-N-ethyl-4-(2-fluorophenyl)-3-[(Z)-(3,4,5-trimethoxyphenyl)methylideneamino]-1,3-thiazol-2-imine (PubChem CID 7974902) has the molecular formula C21H22FN3O3S and a molecular weight of 415.49 g/mol. Its IUPAC name is (Z)-N-ethyl-4-(2-fluorophenyl)-3-[(Z)-(3,4,5-trimethoxyphenyl)methylideneamino]-1,3-thiazol-2-imine.
| Compound Name | (Z)-N-ethyl-4-(2-fluorophenyl)-3-[(Z)-(3,4,5-trimethoxyphenyl)methylideneamino]-1,3-thiazol-2-imine |
|---|---|
| PubChem CID | 7974902 |
| Molecular Formula | C21H22FN3O3S |
| Molecular Weight | 415.49 g/mol |
| Exact Mass | 415.14 |
| IUPAC Name | (Z)-N-ethyl-4-(2-fluorophenyl)-3-[(Z)-(3,4,5-trimethoxyphenyl)methylideneamino]-1,3-thiazol-2-imine |
| SMILES | CC/N=c1\scc(-c2ccccc2F)n1/N=C\c1cc(OC)c(OC)c(OC)c1 |
| InChI | InChI=1S/C21H22FN3O3S/c1-5-23-21-25(17(13-29-21)15-8-6-7-9-16(15)22)24-12-14-10-18(26-2)20(28-4)19(11-14)27-3/h6-13H,5H2,1-4H3/b23-21-,24-12- |
| InChIKey | HHXCDMDTPCWQEZ-LNAOZLHISA-N |
| XLogP | 4.18 |
| TPSA | 57.34 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.49 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|