C18H16FN3S — CID 7959628
(Z)-N-ethyl-3-[(Z)-(4-fluorophenyl)methylideneamino]-4-phenyl-1,3-thiazol-2-imine (PubChem CID 7959628) has the molecular formula C18H16FN3S and a molecular weight of 325.41 g/mol. Its IUPAC name is (Z)-N-ethyl-3-[(Z)-(4-fluorophenyl)methylideneamino]-4-phenyl-1,3-thiazol-2-imine.
| Compound Name | (Z)-N-ethyl-3-[(Z)-(4-fluorophenyl)methylideneamino]-4-phenyl-1,3-thiazol-2-imine |
|---|---|
| PubChem CID | 7959628 |
| Molecular Formula | C18H16FN3S |
| Molecular Weight | 325.41 g/mol |
| Exact Mass | 325.10 |
| IUPAC Name | (Z)-N-ethyl-3-[(Z)-(4-fluorophenyl)methylideneamino]-4-phenyl-1,3-thiazol-2-imine |
| SMILES | CC/N=c1\scc(-c2ccccc2)n1/N=C\c1ccc(F)cc1 |
| InChI | InChI=1S/C18H16FN3S/c1-2-20-18-22(21-12-14-8-10-16(19)11-9-14)17(13-23-18)15-6-4-3-5-7-15/h3-13H,2H2,1H3/b20-18-,21-12- |
| InChIKey | FZKRMMUTPCDLKH-MQUIJPKUSA-N |
| XLogP | 4.16 |
| TPSA | 29.65 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.41 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|