C19H16N4S — CID 23798582
4-[(2-ethylimino-4-phenyl-1,3-thiazol-3-yl)iminomethyl]benzonitrile (PubChem CID 23798582) has the molecular formula C19H16N4S and a molecular weight of 332.43 g/mol. Its IUPAC name is 4-[(2-ethylimino-4-phenyl-1,3-thiazol-3-yl)iminomethyl]benzonitrile.
| Compound Name | 4-[(2-ethylimino-4-phenyl-1,3-thiazol-3-yl)iminomethyl]benzonitrile |
|---|---|
| PubChem CID | 23798582 |
| Molecular Formula | C19H16N4S |
| Molecular Weight | 332.43 g/mol |
| Exact Mass | 332.11 |
| IUPAC Name | 4-[(2-ethylimino-4-phenyl-1,3-thiazol-3-yl)iminomethyl]benzonitrile |
| SMILES | CC/N=c1\scc(-c2ccccc2)n1N=Cc1ccc(C#N)cc1 |
| InChI | InChI=1S/C19H16N4S/c1-2-21-19-23(18(14-24-19)17-6-4-3-5-7-17)22-13-16-10-8-15(12-20)9-11-16/h3-11,13-14H,2H2,1H3/b21-19-,22-13? |
| InChIKey | QERBGRMKBKESAQ-VKCFHCLMSA-N |
| XLogP | 3.89 |
| TPSA | 53.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.43 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|