C21H14N4S2 — CID 23910735
4-[(2-phenylimino-4-thiophen-2-yl-1,3-thiazol-3-yl)iminomethyl]benzonitrile (PubChem CID 23910735) has the molecular formula C21H14N4S2 and a molecular weight of 386.51 g/mol. Its IUPAC name is 4-[(2-phenylimino-4-thiophen-2-yl-1,3-thiazol-3-yl)iminomethyl]benzonitrile.
| Compound Name | 4-[(2-phenylimino-4-thiophen-2-yl-1,3-thiazol-3-yl)iminomethyl]benzonitrile |
|---|---|
| PubChem CID | 23910735 |
| Molecular Formula | C21H14N4S2 |
| Molecular Weight | 386.51 g/mol |
| Exact Mass | 386.07 |
| IUPAC Name | 4-[(2-phenylimino-4-thiophen-2-yl-1,3-thiazol-3-yl)iminomethyl]benzonitrile |
| SMILES | N#Cc1ccc(C=Nn2c(-c3cccs3)cs/c2=N\c2ccccc2)cc1 |
| InChI | InChI=1S/C21H14N4S2/c22-13-16-8-10-17(11-9-16)14-23-25-19(20-7-4-12-26-20)15-27-21(25)24-18-5-2-1-3-6-18/h1-12,14-15H/b23-14?,24-21- |
| InChIKey | MLSBOVNBUJKQPS-RQVKWZPWSA-N |
| XLogP | 5.26 |
| TPSA | 53.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.51 |
| LogP ≤ 5 | 5.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|