C17H16N4OS2 — CID 9368181
N-[4-[(Z)-(2-methylimino-4-thiophen-2-yl-1,3-thiazol-3-yl)iminomethyl]phenyl]acetamide (PubChem CID 9368181) has the molecular formula C17H16N4OS2 and a molecular weight of 356.48 g/mol. Its IUPAC name is N-[4-[(Z)-(2-methylimino-4-thiophen-2-yl-1,3-thiazol-3-yl)iminomethyl]phenyl]acetamide.
| Compound Name | N-[4-[(Z)-(2-methylimino-4-thiophen-2-yl-1,3-thiazol-3-yl)iminomethyl]phenyl]acetamide |
|---|---|
| PubChem CID | 9368181 |
| Molecular Formula | C17H16N4OS2 |
| Molecular Weight | 356.48 g/mol |
| Exact Mass | 356.08 |
| IUPAC Name | N-[4-[(Z)-(2-methylimino-4-thiophen-2-yl-1,3-thiazol-3-yl)iminomethyl]phenyl]acetamide |
| SMILES | C/N=c1\scc(-c2cccs2)n1/N=C\c1ccc(NC(C)=O)cc1 |
| InChI | InChI=1S/C17H16N4OS2/c1-12(22)20-14-7-5-13(6-8-14)10-19-21-15(11-24-17(21)18-2)16-4-3-9-23-16/h3-11H,1-2H3,(H,20,22)/b18-17-,19-10- |
| InChIKey | AHJQRHJTPKWBDS-IAZSKANUSA-N |
| XLogP | 3.65 |
| TPSA | 58.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.48 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|