C25H21N5O3S — CID 6219421
5-[3-[(Z)-(4-acetamidophenyl)methylideneamino]-2-phenylimino-1,3-thiazol-4-yl]-2-hydroxybenzamide (PubChem CID 6219421) has the molecular formula C25H21N5O3S and a molecular weight of 471.54 g/mol. Its IUPAC name is 5-[3-[(Z)-(4-acetamidophenyl)methylideneamino]-2-phenylimino-1,3-thiazol-4-yl]-2-hydroxybenzamide.
| Compound Name | 5-[3-[(Z)-(4-acetamidophenyl)methylideneamino]-2-phenylimino-1,3-thiazol-4-yl]-2-hydroxybenzamide |
|---|---|
| PubChem CID | 6219421 |
| Molecular Formula | C25H21N5O3S |
| Molecular Weight | 471.54 g/mol |
| Exact Mass | 471.14 |
| IUPAC Name | 5-[3-[(Z)-(4-acetamidophenyl)methylideneamino]-2-phenylimino-1,3-thiazol-4-yl]-2-hydroxybenzamide |
| SMILES | CC(=O)Nc1ccc(/C=N\n2c(-c3ccc(O)c(C(N)=O)c3)cs/c2=N\c2ccccc2)cc1 |
| InChI | InChI=1S/C25H21N5O3S/c1-16(31)28-20-10-7-17(8-11-20)14-27-30-22(18-9-12-23(32)21(13-18)24(26)33)15-34-25(30)29-19-5-3-2-4-6-19/h2-15,32H,1H3,(H2,26,33)(H,28,31)/b27-14-,29-25- |
| InChIKey | VCWMWXLEQYSXFP-CBMHIGQASA-N |
| XLogP | 4.09 |
| TPSA | 122.07 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.54 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|