C21H22N4O5S — CID 135775954
5-[2-ethylimino-3-[(E)-(4-hydroxy-3,5-dimethoxyphenyl)methylideneamino]-1,3-thiazol-4-yl]-2-hydroxybenzamide (PubChem CID 135775954) has the molecular formula C21H22N4O5S and a molecular weight of 442.50 g/mol. Its IUPAC name is 5-[2-ethylimino-3-[(E)-(4-hydroxy-3,5-dimethoxyphenyl)methylideneamino]-1,3-thiazol-4-yl]-2-hydroxybenzamide.
| Compound Name | 5-[2-ethylimino-3-[(E)-(4-hydroxy-3,5-dimethoxyphenyl)methylideneamino]-1,3-thiazol-4-yl]-2-hydroxybenzamide |
|---|---|
| PubChem CID | 135775954 |
| Molecular Formula | C21H22N4O5S |
| Molecular Weight | 442.50 g/mol |
| Exact Mass | 442.13 |
| IUPAC Name | 5-[2-ethylimino-3-[(E)-(4-hydroxy-3,5-dimethoxyphenyl)methylideneamino]-1,3-thiazol-4-yl]-2-hydroxybenzamide |
| SMILES | CC/N=c1\scc(-c2ccc(O)c(C(N)=O)c2)n1/N=C/c1cc(OC)c(O)c(OC)c1 |
| InChI | InChI=1S/C21H22N4O5S/c1-4-23-21-25(24-10-12-7-17(29-2)19(27)18(8-12)30-3)15(11-31-21)13-5-6-16(26)14(9-13)20(22)28/h5-11,26-27H,4H2,1-3H3,(H2,22,28)/b23-21-,24-10+ |
| InChIKey | RHMIKENPVOOUTQ-MRDJGTGFSA-N |
| XLogP | 2.55 |
| TPSA | 131.66 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.50 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'hzone_phenol_B(215)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|