C21H21N3O3S — CID 135839028
2,6-dimethoxy-4-[(4-phenyl-2-prop-2-enylimino-1,3-thiazol-3-yl)iminomethyl]phenol (PubChem CID 135839028) has the molecular formula C21H21N3O3S and a molecular weight of 395.48 g/mol. Its IUPAC name is 2,6-dimethoxy-4-[(4-phenyl-2-prop-2-enylimino-1,3-thiazol-3-yl)iminomethyl]phenol.
| Compound Name | 2,6-dimethoxy-4-[(4-phenyl-2-prop-2-enylimino-1,3-thiazol-3-yl)iminomethyl]phenol |
|---|---|
| PubChem CID | 135839028 |
| Molecular Formula | C21H21N3O3S |
| Molecular Weight | 395.48 g/mol |
| Exact Mass | 395.13 |
| IUPAC Name | 2,6-dimethoxy-4-[(4-phenyl-2-prop-2-enylimino-1,3-thiazol-3-yl)iminomethyl]phenol |
| SMILES | C=CC/N=c1\scc(-c2ccccc2)n1N=Cc1cc(OC)c(O)c(OC)c1 |
| InChI | InChI=1S/C21H21N3O3S/c1-4-10-22-21-24(17(14-28-21)16-8-6-5-7-9-16)23-13-15-11-18(26-2)20(25)19(12-15)27-3/h4-9,11-14,25H,1,10H2,2-3H3/b22-21-,23-13? |
| InChIKey | BPRCWBIYOJVEJW-RYRILWMESA-N |
| XLogP | 3.91 |
| TPSA | 68.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.48 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hzone_phenol_B(215)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|