C26H28N4O4S — CID 4560160
2-[2-methoxy-4-[(4-phenyl-2-prop-2-enylimino-1,3-thiazol-3-yl)iminomethyl]phenoxy]-1-morpholin-4-ylethanone (PubChem CID 4560160) has the molecular formula C26H28N4O4S and a molecular weight of 492.60 g/mol. Its IUPAC name is 2-[2-methoxy-4-[(4-phenyl-2-prop-2-enylimino-1,3-thiazol-3-yl)iminomethyl]phenoxy]-1-morpholin-4-ylethanone.
| Compound Name | 2-[2-methoxy-4-[(4-phenyl-2-prop-2-enylimino-1,3-thiazol-3-yl)iminomethyl]phenoxy]-1-morpholin-4-ylethanone |
|---|---|
| PubChem CID | 4560160 |
| Molecular Formula | C26H28N4O4S |
| Molecular Weight | 492.60 g/mol |
| Exact Mass | 492.18 |
| IUPAC Name | 2-[2-methoxy-4-[(4-phenyl-2-prop-2-enylimino-1,3-thiazol-3-yl)iminomethyl]phenoxy]-1-morpholin-4-ylethanone |
| SMILES | C=CC/N=c1\scc(-c2ccccc2)n1N=Cc1ccc(OCC(=O)N2CCOCC2)c(OC)c1 |
| InChI | InChI=1S/C26H28N4O4S/c1-3-11-27-26-30(22(19-35-26)21-7-5-4-6-8-21)28-17-20-9-10-23(24(16-20)32-2)34-18-25(31)29-12-14-33-15-13-29/h3-10,16-17,19H,1,11-15,18H2,2H3/b27-26-,28-17? |
| InChIKey | CIPNQVDRFSEQMG-ITDMPDGGSA-N |
| XLogP | 3.43 |
| TPSA | 77.65 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.60 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|