C26H29N3O4S — CID 23931328
tert-butyl [2-methoxy-4-[[4-(4-methylphenyl)-2-prop-2-enylimino-1,3-thiazol-3-yl]iminomethyl]phenyl] carbonate (PubChem CID 23931328) has the molecular formula C26H29N3O4S and a molecular weight of 479.60 g/mol. Its IUPAC name is tert-butyl [2-methoxy-4-[[4-(4-methylphenyl)-2-prop-2-enylimino-1,3-thiazol-3-yl]iminomethyl]phenyl] carbonate.
| Compound Name | tert-butyl [2-methoxy-4-[[4-(4-methylphenyl)-2-prop-2-enylimino-1,3-thiazol-3-yl]iminomethyl]phenyl] carbonate |
|---|---|
| PubChem CID | 23931328 |
| Molecular Formula | C26H29N3O4S |
| Molecular Weight | 479.60 g/mol |
| Exact Mass | 479.19 |
| IUPAC Name | tert-butyl [2-methoxy-4-[[4-(4-methylphenyl)-2-prop-2-enylimino-1,3-thiazol-3-yl]iminomethyl]phenyl] carbonate |
| SMILES | C=CC/N=c1\scc(-c2ccc(C)cc2)n1N=Cc1ccc(OC(=O)OC(C)(C)C)c(OC)c1 |
| InChI | InChI=1S/C26H29N3O4S/c1-7-14-27-24-29(21(17-34-24)20-11-8-18(2)9-12-20)28-16-19-10-13-22(23(15-19)31-6)32-25(30)33-26(3,4)5/h7-13,15-17H,1,14H2,2-6H3/b27-24-,28-16? |
| InChIKey | FRWCXNMVLNYANB-LCQIWZLBSA-N |
| XLogP | 5.82 |
| TPSA | 74.41 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.60 |
| LogP ≤ 5 | 5.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phenyl_carbonate', 'substructure': 'N/A'} |
|---|