C28H33N3O6S — CID 23910819
tert-butyl [4-[[4-(2,4-dimethoxyphenyl)-2-(2-methylprop-2-enylimino)-1,3-thiazol-3-yl]iminomethyl]-2-methoxyphenyl] carbonate (PubChem CID 23910819) has the molecular formula C28H33N3O6S and a molecular weight of 539.65 g/mol. Its IUPAC name is tert-butyl [4-[[4-(2,4-dimethoxyphenyl)-2-(2-methylprop-2-enylimino)-1,3-thiazol-3-yl]iminomethyl]-2-methoxyphenyl] carbonate.
| Compound Name | tert-butyl [4-[[4-(2,4-dimethoxyphenyl)-2-(2-methylprop-2-enylimino)-1,3-thiazol-3-yl]iminomethyl]-2-methoxyphenyl] carbonate |
|---|---|
| PubChem CID | 23910819 |
| Molecular Formula | C28H33N3O6S |
| Molecular Weight | 539.65 g/mol |
| Exact Mass | 539.21 |
| IUPAC Name | tert-butyl [4-[[4-(2,4-dimethoxyphenyl)-2-(2-methylprop-2-enylimino)-1,3-thiazol-3-yl]iminomethyl]-2-methoxyphenyl] carbonate |
| SMILES | C=C(C)C/N=c1\scc(-c2ccc(OC)cc2OC)n1N=Cc1ccc(OC(=O)OC(C)(C)C)c(OC)c1 |
| InChI | InChI=1S/C28H33N3O6S/c1-18(2)15-29-26-31(22(17-38-26)21-11-10-20(33-6)14-24(21)34-7)30-16-19-9-12-23(25(13-19)35-8)36-27(32)37-28(3,4)5/h9-14,16-17H,1,15H2,2-8H3/b29-26-,30-16? |
| InChIKey | RLUXFWRTERPISL-GFIFRGSWSA-N |
| XLogP | 5.92 |
| TPSA | 92.87 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 539.65 |
| LogP ≤ 5 | 5.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phenyl_carbonate', 'substructure': 'N/A'} |
|---|