C24H23N3O3S — CID 23734737
4-(1-benzofuran-2-yl)-3-[(3,4-dimethoxyphenyl)methylideneamino]-N-(2-methylprop-2-enyl)-1,3-thiazol-2-imine (PubChem CID 23734737) has the molecular formula C24H23N3O3S and a molecular weight of 433.53 g/mol. Its IUPAC name is 4-(1-benzofuran-2-yl)-3-[(3,4-dimethoxyphenyl)methylideneamino]-N-(2-methylprop-2-enyl)-1,3-thiazol-2-imine.
| Compound Name | 4-(1-benzofuran-2-yl)-3-[(3,4-dimethoxyphenyl)methylideneamino]-N-(2-methylprop-2-enyl)-1,3-thiazol-2-imine |
|---|---|
| PubChem CID | 23734737 |
| Molecular Formula | C24H23N3O3S |
| Molecular Weight | 433.53 g/mol |
| Exact Mass | 433.15 |
| IUPAC Name | 4-(1-benzofuran-2-yl)-3-[(3,4-dimethoxyphenyl)methylideneamino]-N-(2-methylprop-2-enyl)-1,3-thiazol-2-imine |
| SMILES | C=C(C)C/N=c1\scc(-c2cc3ccccc3o2)n1N=Cc1ccc(OC)c(OC)c1 |
| InChI | InChI=1S/C24H23N3O3S/c1-16(2)13-25-24-27(26-14-17-9-10-21(28-3)23(11-17)29-4)19(15-31-24)22-12-18-7-5-6-8-20(18)30-22/h5-12,14-15H,1,13H2,2-4H3/b25-24-,26-14? |
| InChIKey | XCSDRLOBJJRCQD-JACWKWRKSA-N |
| XLogP | 5.34 |
| TPSA | 61.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.53 |
| LogP ≤ 5 | 5.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|