C21H17N3O3S — CID 135548999
4-[[4-(1-benzofuran-2-yl)-2-prop-2-enylimino-1,3-thiazol-3-yl]iminomethyl]benzene-1,2-diol (PubChem CID 135548999) has the molecular formula C21H17N3O3S and a molecular weight of 391.45 g/mol. Its IUPAC name is 4-[[4-(1-benzofuran-2-yl)-2-prop-2-enylimino-1,3-thiazol-3-yl]iminomethyl]benzene-1,2-diol.
| Compound Name | 4-[[4-(1-benzofuran-2-yl)-2-prop-2-enylimino-1,3-thiazol-3-yl]iminomethyl]benzene-1,2-diol |
|---|---|
| PubChem CID | 135548999 |
| Molecular Formula | C21H17N3O3S |
| Molecular Weight | 391.45 g/mol |
| Exact Mass | 391.10 |
| IUPAC Name | 4-[[4-(1-benzofuran-2-yl)-2-prop-2-enylimino-1,3-thiazol-3-yl]iminomethyl]benzene-1,2-diol |
| SMILES | C=CC/N=c1\scc(-c2cc3ccccc3o2)n1N=Cc1ccc(O)c(O)c1 |
| InChI | InChI=1S/C21H17N3O3S/c1-2-9-22-21-24(23-12-14-7-8-17(25)18(26)10-14)16(13-28-21)20-11-15-5-3-4-6-19(15)27-20/h2-8,10-13,25-26H,1,9H2/b22-21-,23-12? |
| InChIKey | YGQZNRLKSKHJLX-XTWJKVAUSA-N |
| XLogP | 4.34 |
| TPSA | 83.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.45 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hzone_phenol_B(215)', 'substructure': 'N/A'}, {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|