C23H18N4OS — CID 135843302
4-(1-benzofuran-2-yl)-3-(1H-indol-3-ylmethylideneamino)-N-prop-2-enyl-1,3-thiazol-2-imine (PubChem CID 135843302) has the molecular formula C23H18N4OS and a molecular weight of 398.49 g/mol. Its IUPAC name is 4-(1-benzofuran-2-yl)-3-(1H-indol-3-ylmethylideneamino)-N-prop-2-enyl-1,3-thiazol-2-imine.
| Compound Name | 4-(1-benzofuran-2-yl)-3-(1H-indol-3-ylmethylideneamino)-N-prop-2-enyl-1,3-thiazol-2-imine |
|---|---|
| PubChem CID | 135843302 |
| Molecular Formula | C23H18N4OS |
| Molecular Weight | 398.49 g/mol |
| Exact Mass | 398.12 |
| IUPAC Name | 4-(1-benzofuran-2-yl)-3-(1H-indol-3-ylmethylideneamino)-N-prop-2-enyl-1,3-thiazol-2-imine |
| SMILES | C=CC/N=c1\scc(-c2cc3ccccc3o2)n1N=Cc1c[nH]c2ccccc12 |
| InChI | InChI=1S/C23H18N4OS/c1-2-11-24-23-27(26-14-17-13-25-19-9-5-4-8-18(17)19)20(15-29-23)22-12-16-7-3-6-10-21(16)28-22/h2-10,12-15,25H,1,11H2/b24-23-,26-14? |
| InChIKey | NTFDDMNVCHFWFN-PLGUPOGLSA-N |
| XLogP | 5.41 |
| TPSA | 58.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.49 |
| LogP ≤ 5 | 5.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|