C19H14N4O4S — CID 23798220
4-(1-benzofuran-2-yl)-3-[(5-nitrofuran-2-yl)methylideneamino]-N-prop-2-enyl-1,3-thiazol-2-imine (PubChem CID 23798220) has the molecular formula C19H14N4O4S and a molecular weight of 394.41 g/mol. Its IUPAC name is 4-(1-benzofuran-2-yl)-3-[(5-nitrofuran-2-yl)methylideneamino]-N-prop-2-enyl-1,3-thiazol-2-imine.
| Compound Name | 4-(1-benzofuran-2-yl)-3-[(5-nitrofuran-2-yl)methylideneamino]-N-prop-2-enyl-1,3-thiazol-2-imine |
|---|---|
| PubChem CID | 23798220 |
| Molecular Formula | C19H14N4O4S |
| Molecular Weight | 394.41 g/mol |
| Exact Mass | 394.07 |
| IUPAC Name | 4-(1-benzofuran-2-yl)-3-[(5-nitrofuran-2-yl)methylideneamino]-N-prop-2-enyl-1,3-thiazol-2-imine |
| SMILES | C=CC/N=c1\scc(-c2cc3ccccc3o2)n1N=Cc1ccc([N+](=O)[O-])o1 |
| InChI | InChI=1S/C19H14N4O4S/c1-2-9-20-19-22(21-11-14-7-8-18(26-14)23(24)25)15(12-28-19)17-10-13-5-3-4-6-16(13)27-17/h2-8,10-12H,1,9H2/b20-19-,21-11? |
| InChIKey | VRHKCENHYARNMY-PCSFFSRSSA-N |
| XLogP | 4.43 |
| TPSA | 99.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.41 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|