C24H18N4O4S — CID 23740733
4-(1-benzofuran-2-yl)-N-(3,4-dimethylphenyl)-3-[(5-nitrofuran-2-yl)methylideneamino]-1,3-thiazol-2-imine (PubChem CID 23740733) has the molecular formula C24H18N4O4S and a molecular weight of 458.50 g/mol. Its IUPAC name is 4-(1-benzofuran-2-yl)-N-(3,4-dimethylphenyl)-3-[(5-nitrofuran-2-yl)methylideneamino]-1,3-thiazol-2-imine.
| Compound Name | 4-(1-benzofuran-2-yl)-N-(3,4-dimethylphenyl)-3-[(5-nitrofuran-2-yl)methylideneamino]-1,3-thiazol-2-imine |
|---|---|
| PubChem CID | 23740733 |
| Molecular Formula | C24H18N4O4S |
| Molecular Weight | 458.50 g/mol |
| Exact Mass | 458.10 |
| IUPAC Name | 4-(1-benzofuran-2-yl)-N-(3,4-dimethylphenyl)-3-[(5-nitrofuran-2-yl)methylideneamino]-1,3-thiazol-2-imine |
| SMILES | Cc1ccc(/N=c2\scc(-c3cc4ccccc4o3)n2N=Cc2ccc([N+](=O)[O-])o2)cc1C |
| InChI | InChI=1S/C24H18N4O4S/c1-15-7-8-18(11-16(15)2)26-24-27(25-13-19-9-10-23(31-19)28(29)30)20(14-33-24)22-12-17-5-3-4-6-21(17)32-22/h3-14H,1-2H3/b25-13?,26-24- |
| InChIKey | CJQGSBAEDMBQRE-BLYZZTRNSA-N |
| XLogP | 6.20 |
| TPSA | 99.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.50 |
| LogP ≤ 5 | 6.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|