C18H10Cl2N4O3S2 — CID 23795166
N-(3,4-dichlorophenyl)-3-[(5-nitrofuran-2-yl)methylideneamino]-4-thiophen-2-yl-1,3-thiazol-2-imine (PubChem CID 23795166) has the molecular formula C18H10Cl2N4O3S2 and a molecular weight of 465.34 g/mol. Its IUPAC name is N-(3,4-dichlorophenyl)-3-[(5-nitrofuran-2-yl)methylideneamino]-4-thiophen-2-yl-1,3-thiazol-2-imine.
| Compound Name | N-(3,4-dichlorophenyl)-3-[(5-nitrofuran-2-yl)methylideneamino]-4-thiophen-2-yl-1,3-thiazol-2-imine |
|---|---|
| PubChem CID | 23795166 |
| Molecular Formula | C18H10Cl2N4O3S2 |
| Molecular Weight | 465.34 g/mol |
| Exact Mass | 463.96 |
| IUPAC Name | N-(3,4-dichlorophenyl)-3-[(5-nitrofuran-2-yl)methylideneamino]-4-thiophen-2-yl-1,3-thiazol-2-imine |
| SMILES | O=[N+]([O-])c1ccc(C=Nn2c(-c3cccs3)cs/c2=N\c2ccc(Cl)c(Cl)c2)o1 |
| InChI | InChI=1S/C18H10Cl2N4O3S2/c19-13-5-3-11(8-14(13)20)22-18-23(15(10-29-18)16-2-1-7-28-16)21-9-12-4-6-17(27-12)24(25)26/h1-10H/b21-9?,22-18- |
| InChIKey | PXKIUNLKCDOZPI-JXCYNEGKSA-N |
| XLogP | 6.20 |
| TPSA | 85.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.34 |
| LogP ≤ 5 | 6.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|