C20H13Cl2N3O3S2 — CID 135666184
4-[[2-(3,4-dichlorophenyl)imino-4-thiophen-2-yl-1,3-thiazol-3-yl]iminomethyl]benzene-1,2,3-triol (PubChem CID 135666184) has the molecular formula C20H13Cl2N3O3S2 and a molecular weight of 478.38 g/mol. Its IUPAC name is 4-[[2-(3,4-dichlorophenyl)imino-4-thiophen-2-yl-1,3-thiazol-3-yl]iminomethyl]benzene-1,2,3-triol.
| Compound Name | 4-[[2-(3,4-dichlorophenyl)imino-4-thiophen-2-yl-1,3-thiazol-3-yl]iminomethyl]benzene-1,2,3-triol |
|---|---|
| PubChem CID | 135666184 |
| Molecular Formula | C20H13Cl2N3O3S2 |
| Molecular Weight | 478.38 g/mol |
| Exact Mass | 476.98 |
| IUPAC Name | 4-[[2-(3,4-dichlorophenyl)imino-4-thiophen-2-yl-1,3-thiazol-3-yl]iminomethyl]benzene-1,2,3-triol |
| SMILES | Oc1ccc(C=Nn2c(-c3cccs3)cs/c2=N\c2ccc(Cl)c(Cl)c2)c(O)c1O |
| InChI | InChI=1S/C20H13Cl2N3O3S2/c21-13-5-4-12(8-14(13)22)24-20-25(15(10-30-20)17-2-1-7-29-17)23-9-11-3-6-16(26)19(28)18(11)27/h1-10,26-28H/b23-9?,24-20- |
| InChIKey | WFXFSJMQRSFCEA-HQQGAEDPSA-N |
| XLogP | 5.82 |
| TPSA | 90.34 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.38 |
| LogP ≤ 5 | 5.82 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'hzone_phenol_A(479)', 'substructure': 'N/A'}, {'alert_name': 'hzone_phenol_B(215)', 'substructure': 'N/A'}, {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|