C20H17Cl2N3O3S — CID 135798839
4-[[4-(2,5-dichlorophenyl)-2-(2-methylprop-2-enylimino)-1,3-thiazol-3-yl]iminomethyl]benzene-1,2,3-triol (PubChem CID 135798839) has the molecular formula C20H17Cl2N3O3S and a molecular weight of 450.35 g/mol. Its IUPAC name is 4-[[4-(2,5-dichlorophenyl)-2-(2-methylprop-2-enylimino)-1,3-thiazol-3-yl]iminomethyl]benzene-1,2,3-triol.
| Compound Name | 4-[[4-(2,5-dichlorophenyl)-2-(2-methylprop-2-enylimino)-1,3-thiazol-3-yl]iminomethyl]benzene-1,2,3-triol |
|---|---|
| PubChem CID | 135798839 |
| Molecular Formula | C20H17Cl2N3O3S |
| Molecular Weight | 450.35 g/mol |
| Exact Mass | 449.04 |
| IUPAC Name | 4-[[4-(2,5-dichlorophenyl)-2-(2-methylprop-2-enylimino)-1,3-thiazol-3-yl]iminomethyl]benzene-1,2,3-triol |
| SMILES | C=C(C)C/N=c1\scc(-c2cc(Cl)ccc2Cl)n1N=Cc1ccc(O)c(O)c1O |
| InChI | InChI=1S/C20H17Cl2N3O3S/c1-11(2)8-23-20-25(24-9-12-3-6-17(26)19(28)18(12)27)16(10-29-20)14-7-13(21)4-5-15(14)22/h3-7,9-10,26-28H,1,8H2,2H3/b23-20-,24-9? |
| InChIKey | GARRNIVEWMLJMI-QLZSLHJKSA-N |
| XLogP | 5.00 |
| TPSA | 90.34 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.35 |
| LogP ≤ 5 | 5.00 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hzone_phenol_A(479)', 'substructure': 'N/A'}, {'alert_name': 'hzone_phenol_B(215)', 'substructure': 'N/A'}, {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|