C25H23N3O5S — CID 135841026
4-[[2-benzylimino-4-(2,4-dimethoxyphenyl)-1,3-thiazol-3-yl]iminomethyl]benzene-1,2,3-triol (PubChem CID 135841026) has the molecular formula C25H23N3O5S and a molecular weight of 477.54 g/mol. Its IUPAC name is 4-[[2-benzylimino-4-(2,4-dimethoxyphenyl)-1,3-thiazol-3-yl]iminomethyl]benzene-1,2,3-triol.
| Compound Name | 4-[[2-benzylimino-4-(2,4-dimethoxyphenyl)-1,3-thiazol-3-yl]iminomethyl]benzene-1,2,3-triol |
|---|---|
| PubChem CID | 135841026 |
| Molecular Formula | C25H23N3O5S |
| Molecular Weight | 477.54 g/mol |
| Exact Mass | 477.14 |
| IUPAC Name | 4-[[2-benzylimino-4-(2,4-dimethoxyphenyl)-1,3-thiazol-3-yl]iminomethyl]benzene-1,2,3-triol |
| SMILES | COc1ccc(-c2cs/c(=N\Cc3ccccc3)n2N=Cc2ccc(O)c(O)c2O)c(OC)c1 |
| InChI | InChI=1S/C25H23N3O5S/c1-32-18-9-10-19(22(12-18)33-2)20-15-34-25(26-13-16-6-4-3-5-7-16)28(20)27-14-17-8-11-21(29)24(31)23(17)30/h3-12,14-15,29-31H,13H2,1-2H3/b26-25-,27-14? |
| InChIKey | XTKPJIVTDVPSMI-CBWAXPTJSA-N |
| XLogP | 4.33 |
| TPSA | 108.80 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.54 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'hzone_phenol_A(479)', 'substructure': 'N/A'}, {'alert_name': 'hzone_phenol_B(215)', 'substructure': 'N/A'}, {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|