C27H26BrN3O4S — CID 135556373
2-bromo-4-[[4-(2,4-dimethoxyphenyl)-2-(2-phenylethylimino)-1,3-thiazol-3-yl]iminomethyl]-6-methoxyphenol (PubChem CID 135556373) has the molecular formula C27H26BrN3O4S and a molecular weight of 568.49 g/mol. Its IUPAC name is 2-bromo-4-[[4-(2,4-dimethoxyphenyl)-2-(2-phenylethylimino)-1,3-thiazol-3-yl]iminomethyl]-6-methoxyphenol.
| Compound Name | 2-bromo-4-[[4-(2,4-dimethoxyphenyl)-2-(2-phenylethylimino)-1,3-thiazol-3-yl]iminomethyl]-6-methoxyphenol |
|---|---|
| PubChem CID | 135556373 |
| Molecular Formula | C27H26BrN3O4S |
| Molecular Weight | 568.49 g/mol |
| Exact Mass | 567.08 |
| IUPAC Name | 2-bromo-4-[[4-(2,4-dimethoxyphenyl)-2-(2-phenylethylimino)-1,3-thiazol-3-yl]iminomethyl]-6-methoxyphenol |
| SMILES | COc1ccc(-c2cs/c(=N\CCc3ccccc3)n2N=Cc2cc(Br)c(O)c(OC)c2)c(OC)c1 |
| InChI | InChI=1S/C27H26BrN3O4S/c1-33-20-9-10-21(24(15-20)34-2)23-17-36-27(29-12-11-18-7-5-4-6-8-18)31(23)30-16-19-13-22(28)26(32)25(14-19)35-3/h4-10,13-17,32H,11-12H2,1-3H3/b29-27-,30-16? |
| InChIKey | NMVKGJCYDWYISW-QOBLKEAHSA-N |
| XLogP | 5.74 |
| TPSA | 77.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 568.49 |
| LogP ≤ 5 | 5.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'hzone_phenol_B(215)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|