C20H18BrCl2N3O3S — CID 135691072
2-bromo-4-[(E)-[4-(2,4-dichlorophenyl)-2-(2-methoxyethylimino)-1,3-thiazol-3-yl]iminomethyl]-6-methoxyphenol (PubChem CID 135691072) has the molecular formula C20H18BrCl2N3O3S and a molecular weight of 531.26 g/mol. Its IUPAC name is 2-bromo-4-[(E)-[4-(2,4-dichlorophenyl)-2-(2-methoxyethylimino)-1,3-thiazol-3-yl]iminomethyl]-6-methoxyphenol.
| Compound Name | 2-bromo-4-[(E)-[4-(2,4-dichlorophenyl)-2-(2-methoxyethylimino)-1,3-thiazol-3-yl]iminomethyl]-6-methoxyphenol |
|---|---|
| PubChem CID | 135691072 |
| Molecular Formula | C20H18BrCl2N3O3S |
| Molecular Weight | 531.26 g/mol |
| Exact Mass | 528.96 |
| IUPAC Name | 2-bromo-4-[(E)-[4-(2,4-dichlorophenyl)-2-(2-methoxyethylimino)-1,3-thiazol-3-yl]iminomethyl]-6-methoxyphenol |
| SMILES | COCC/N=c1\scc(-c2ccc(Cl)cc2Cl)n1/N=C/c1cc(Br)c(O)c(OC)c1 |
| InChI | InChI=1S/C20H18BrCl2N3O3S/c1-28-6-5-24-20-26(17(11-30-20)14-4-3-13(22)9-16(14)23)25-10-12-7-15(21)19(27)18(8-12)29-2/h3-4,7-11,27H,5-6H2,1-2H3/b24-20-,25-10+ |
| InChIKey | BORRWNKXJGBHEI-CGJSSHERSA-N |
| XLogP | 5.43 |
| TPSA | 68.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 531.26 |
| LogP ≤ 5 | 5.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hzone_phenol_B(215)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|