C18H16BrN3O2S — CID 135760996
2-bromo-6-methoxy-4-[(2-methylimino-4-phenyl-1,3-thiazol-3-yl)iminomethyl]phenol (PubChem CID 135760996) has the molecular formula C18H16BrN3O2S and a molecular weight of 418.32 g/mol. Its IUPAC name is 2-bromo-6-methoxy-4-[(2-methylimino-4-phenyl-1,3-thiazol-3-yl)iminomethyl]phenol.
| Compound Name | 2-bromo-6-methoxy-4-[(2-methylimino-4-phenyl-1,3-thiazol-3-yl)iminomethyl]phenol |
|---|---|
| PubChem CID | 135760996 |
| Molecular Formula | C18H16BrN3O2S |
| Molecular Weight | 418.32 g/mol |
| Exact Mass | 417.01 |
| IUPAC Name | 2-bromo-6-methoxy-4-[(2-methylimino-4-phenyl-1,3-thiazol-3-yl)iminomethyl]phenol |
| SMILES | C/N=c1\scc(-c2ccccc2)n1N=Cc1cc(Br)c(O)c(OC)c1 |
| InChI | InChI=1S/C18H16BrN3O2S/c1-20-18-22(15(11-25-18)13-6-4-3-5-7-13)21-10-12-8-14(19)17(23)16(9-12)24-2/h3-11,23H,1-2H3/b20-18-,21-10? |
| InChIKey | CFUWPMPPXWKZHT-RMPIYHTBSA-N |
| XLogP | 4.11 |
| TPSA | 59.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.32 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hzone_phenol_B(215)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|